C28H22N4OS — CID 39919821
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diphenylacetamide (PubChem CID 39919821) has the molecular formula C28H22N4OS and a molecular weight of 462.58 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diphenylacetamide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 39919821 |
| Molecular Formula | C28H22N4OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N,N-diphenylacetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4OS/c33-26(31(23-15-7-2-8-16-23)24-17-9-3-10-18-24)21-34-28-30-29-27(22-13-5-1-6-14-22)32(28)25-19-11-4-12-20-25/h1-20H,21H2 |
| InChIKey | RZHHIYWEELYSLP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |