About 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide
2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide (PubChem CID 104590375) has the molecular formula C15H15NO2S
and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide |
| PubChem CID | 104590375 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CSc1cccc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2S/c1-16(12-6-3-2-4-7-12)15(18)11-19-14-9-5-8-13(17)10-14/h2-10,17H,11H2,1H3 |
| InChIKey | GKQGESDHMVQTMX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide?
The IUPAC name of 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide (CID 104590375) is 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide.
What is the SMILES notation for 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide?
The canonical SMILES for 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide is CN(C(=O)CSc1cccc(O)c1)c1ccccc1.
What is the InChIKey of 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide?
The InChIKey is GKQGESDHMVQTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c1-16(12-6-3-2-4-7-12)15(18)11-19-14-9-5-8-13(17)10-14/h2-10,17H,11H2,1H3.
What are the key properties of 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide?
2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide has a molecular weight of 273.36 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyphenyl)sulfanyl-N-methyl-N-phenylacetamide is sourced from PubChem (CID 104590375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).