About 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide
2-tert-butylsulfanyl-N-methyl-N-phenylacetamide (PubChem CID 23518875) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide.
Molecular Properties
| Compound Name | 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide |
| PubChem CID | 23518875 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CSC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H19NOS/c1-13(2,3)16-10-12(15)14(4)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | MIUNXEBPYLJVKQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide?
The IUPAC name of 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide (CID 23518875) is 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide.
What is the SMILES notation for 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide?
The canonical SMILES for 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide is CN(C(=O)CSC(C)(C)C)c1ccccc1.
What is the InChIKey of 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide?
The InChIKey is MIUNXEBPYLJVKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-13(2,3)16-10-12(15)14(4)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3.
What are the key properties of 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide?
2-tert-butylsulfanyl-N-methyl-N-phenylacetamide has a molecular weight of 237.37 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylsulfanyl-N-methyl-N-phenylacetamide is sourced from PubChem (CID 23518875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).