C14H19NO2 — CID 134872382
N,4,4-trimethyl-3-oxo-N-phenylpentanamide (PubChem CID 134872382) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N,4,4-trimethyl-3-oxo-N-phenylpentanamide.
| Compound Name | N,4,4-trimethyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 134872382 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N,4,4-trimethyl-3-oxo-N-phenylpentanamide |
| SMILES | CN(C(=O)CC(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2/c1-14(2,3)12(16)10-13(17)15(4)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | YBRMBUZVXRLRAT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|