C11H13F3N2O — CID 78914951
N-methyl-N-phenyl-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78914951) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-methyl-N-phenyl-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78914951 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-methyl-N-phenyl-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CN(C(=O)CNCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H13F3N2O/c1-16(9-5-3-2-4-6-9)10(17)7-15-8-11(12,13)14/h2-6,15H,7-8H2,1H3 |
| InChIKey | TZCHPQCTWNTRAD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |