C15H21F3N2O — CID 78958322
N-methyl-N-(4-phenylbutyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78958322) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is N-methyl-N-(4-phenylbutyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-methyl-N-(4-phenylbutyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78958322 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-methyl-N-(4-phenylbutyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CN(CCCCc1ccccc1)C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O/c1-20(14(21)11-19-12-15(16,17)18)10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,19H,5-6,9-12H2,1H3 |
| InChIKey | LEXIUMAJCSHJPB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|