C21H23F5N2O2 — CID 71152051
2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-N-methyl-N-phenylacetamide (PubChem CID 71152051) has the molecular formula C21H23F5N2O2 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 71152051 |
| Molecular Formula | C21H23F5N2O2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[[2,2-difluoro-2-[3-(4,4,4-trifluorobutoxy)phenyl]ethyl]amino]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CNCC(F)(F)c1cccc(OCCCC(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H23F5N2O2/c1-28(17-8-3-2-4-9-17)19(29)14-27-15-20(22,23)16-7-5-10-18(13-16)30-12-6-11-21(24,25)26/h2-5,7-10,13,27H,6,11-12,14-15H2,1H3 |
| InChIKey | VIKGAKSHMJHQQE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|