C12H14BrNO2S — CID 79532965
4-(2-amino-5-bromophenyl)sulfanyl-2-ethylbut-2-enoic acid (PubChem CID 79532965) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is 4-(2-amino-5-bromophenyl)sulfanyl-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2-amino-5-bromophenyl)sulfanyl-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 79532965 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-(2-amino-5-bromophenyl)sulfanyl-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCSc1cc(Br)ccc1N)C(=O)O |
| InChI | InChI=1S/C12H14BrNO2S/c1-2-8(12(15)16)5-6-17-11-7-9(13)3-4-10(11)14/h3-5,7H,2,6,14H2,1H3,(H,15,16) |
| InChIKey | FHBMIWWWDZLRPY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|