C13H17NO3S — CID 79511170
4-(2-amino-5-methoxyphenyl)sulfanyl-2-ethylbut-2-enoic acid (PubChem CID 79511170) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-(2-amino-5-methoxyphenyl)sulfanyl-2-ethylbut-2-enoic acid.
| Compound Name | 4-(2-amino-5-methoxyphenyl)sulfanyl-2-ethylbut-2-enoic acid |
|---|---|
| PubChem CID | 79511170 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-(2-amino-5-methoxyphenyl)sulfanyl-2-ethylbut-2-enoic acid |
| SMILES | CCC(=CCSc1cc(OC)ccc1N)C(=O)O |
| InChI | InChI=1S/C13H17NO3S/c1-3-9(13(15)16)6-7-18-12-8-10(17-2)4-5-11(12)14/h4-6,8H,3,7,14H2,1-2H3,(H,15,16) |
| InChIKey | FPDAUSDIIVLGDJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|