C16H25NO3S — CID 146268756
2-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-ethylhexanoic acid (PubChem CID 146268756) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-ethylhexanoic acid.
| Compound Name | 2-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-ethylhexanoic acid |
|---|---|
| PubChem CID | 146268756 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-ethylhexanoic acid |
| SMILES | CCCCC(CC)(CSc1cc(OC)ccc1N)C(=O)O |
| InChI | InChI=1S/C16H25NO3S/c1-4-6-9-16(5-2,15(18)19)11-21-14-10-12(20-3)7-8-13(14)17/h7-8,10H,4-6,9,11,17H2,1-3H3,(H,18,19) |
| InChIKey | PHAHKRPOVINHPT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|