C18H29NO3S — CID 174976640
3-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-butylhexanoic acid (PubChem CID 174976640) has the molecular formula C18H29NO3S and a molecular weight of 339.50 g/mol. Its IUPAC name is 3-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-butylhexanoic acid.
| Compound Name | 3-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-butylhexanoic acid |
|---|---|
| PubChem CID | 174976640 |
| Molecular Formula | C18H29NO3S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 3-[(2-amino-5-methoxyphenyl)sulfanylmethyl]-2-butylhexanoic acid |
| SMILES | CCCCC(C(=O)O)C(CCC)CSc1cc(OC)ccc1N |
| InChI | InChI=1S/C18H29NO3S/c1-4-6-8-15(18(20)21)13(7-5-2)12-23-17-11-14(22-3)9-10-16(17)19/h9-11,13,15H,4-8,12,19H2,1-3H3,(H,20,21) |
| InChIKey | JGAMAYXVZXRNOS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|