C17H26O4 — CID 125467434
(2S)-2-[(1S)-1-(3,5-dimethoxyphenyl)ethyl]heptanoic acid (PubChem CID 125467434) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-(3,5-dimethoxyphenyl)ethyl]heptanoic acid.
| Compound Name | (2S)-2-[(1S)-1-(3,5-dimethoxyphenyl)ethyl]heptanoic acid |
|---|---|
| PubChem CID | 125467434 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2S)-2-[(1S)-1-(3,5-dimethoxyphenyl)ethyl]heptanoic acid |
| SMILES | CCCCC[C@H](C(=O)O)[C@H](C)c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C17H26O4/c1-5-6-7-8-16(17(18)19)12(2)13-9-14(20-3)11-15(10-13)21-4/h9-12,16H,5-8H2,1-4H3,(H,18,19)/t12-,16+/m1/s1 |
| InChIKey | DVYDFNNFHLELQN-WBMJQRKESA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|