C10H14BrNOS — CID 79533607
1-(2-amino-5-bromophenyl)sulfanylbutan-2-ol (PubChem CID 79533607) has the molecular formula C10H14BrNOS and a molecular weight of 276.20 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)sulfanylbutan-2-ol.
| Compound Name | 1-(2-amino-5-bromophenyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 79533607 |
| Molecular Formula | C10H14BrNOS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)sulfanylbutan-2-ol |
| SMILES | CCC(O)CSc1cc(Br)ccc1N |
| InChI | InChI=1S/C10H14BrNOS/c1-2-8(13)6-14-10-5-7(11)3-4-9(10)12/h3-5,8,13H,2,6,12H2,1H3 |
| InChIKey | FRAXIJVSHSGJQW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|