C3H6F6N2O — CID 172729995
1,2,2,3,3,3-hexafluoropropane-1,1-diamine;hydrate (PubChem CID 172729995) has the molecular formula C3H6F6N2O and a molecular weight of 200.08 g/mol. Its IUPAC name is 1,2,2,3,3,3-hexafluoropropane-1,1-diamine;hydrate.
| Compound Name | 1,2,2,3,3,3-hexafluoropropane-1,1-diamine;hydrate |
|---|---|
| PubChem CID | 172729995 |
| Molecular Formula | C3H6F6N2O |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,2,2,3,3,3-hexafluoropropane-1,1-diamine;hydrate |
| SMILES | NC(N)(F)C(F)(F)C(F)(F)F.O |
| InChI | InChI=1S/C3H4F6N2.H2O/c4-1(5,2(6,7)8)3(9,10)11;/h10-11H2;1H2 |
| InChIKey | HQWRUBJTAODMDK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|