C6H8F9NO — CID 175042472
ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutan-1-amine (PubChem CID 175042472) has the molecular formula C6H8F9NO and a molecular weight of 281.12 g/mol. Its IUPAC name is ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutan-1-amine.
| Compound Name | ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutan-1-amine |
|---|---|
| PubChem CID | 175042472 |
| Molecular Formula | C6H8F9NO |
| Molecular Weight | 281.12 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | ethanol;1,1,2,2,3,3,4,4,4-nonafluorobutan-1-amine |
| SMILES | CCO.NC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4H2F9N.C2H6O/c5-1(6,3(9,10)11)2(7,8)4(12,13)14;1-2-3/h14H2;3H,2H2,1H3 |
| InChIKey | WBTSIDLWCWKBEJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.12 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|