C8H12F13N2O4P — CID 175539691
azane;N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-1-amine;phosphoric acid (PubChem CID 175539691) has the molecular formula C8H12F13N2O4P and a molecular weight of 478.14 g/mol. Its IUPAC name is azane;N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-1-amine;phosphoric acid.
| Compound Name | azane;N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-1-amine;phosphoric acid |
|---|---|
| PubChem CID | 175539691 |
| Molecular Formula | C8H12F13N2O4P |
| Molecular Weight | 478.14 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | azane;N-ethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexan-1-amine;phosphoric acid |
| SMILES | CCNC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.N.O=P(O)(O)O |
| InChI | InChI=1S/C8H6F13N.H3N.H3O4P/c1-2-22-8(20,21)6(15,16)4(11,12)3(9,10)5(13,14)7(17,18)19;;1-5(2,3)4/h22H,2H2,1H3;1H3;(H3,1,2,3,4) |
| InChIKey | QCAHSIZSKAKORP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|