C12H18F9N — CID 90695405
N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-amine (PubChem CID 90695405) has the molecular formula C12H18F9N and a molecular weight of 347.27 g/mol. Its IUPAC name is N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-amine.
| Compound Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-amine |
|---|---|
| PubChem CID | 90695405 |
| Molecular Formula | C12H18F9N |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-amine |
| SMILES | CCCCCCCCNC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H18F9N/c1-2-3-4-5-6-7-8-22-12(20,21)10(15,16)9(13,14)11(17,18)19/h22H,2-8H2,1H3 |
| InChIKey | YOYSFBPHJZYWSA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|