C9H12F9N — CID 91298724
3-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine (PubChem CID 91298724) has the molecular formula C9H12F9N and a molecular weight of 305.18 g/mol. Its IUPAC name is 3-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine.
| Compound Name | 3-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine |
|---|---|
| PubChem CID | 91298724 |
| Molecular Formula | C9H12F9N |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-methyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)butan-1-amine |
| SMILES | CC(C)CCNC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F9N/c1-5(2)3-4-19-9(17,18)7(12,13)6(10,11)8(14,15)16/h5,19H,3-4H2,1-2H3 |
| InChIKey | KAJLQUDSBJPUSD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|