C25H30F9N — CID 157464882
1,1'-biphenyl;3-ethyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)heptan-1-amine (PubChem CID 157464882) has the molecular formula C25H30F9N and a molecular weight of 515.50 g/mol. Its IUPAC name is 1,1'-biphenyl;3-ethyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)heptan-1-amine.
| Compound Name | 1,1'-biphenyl;3-ethyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)heptan-1-amine |
|---|---|
| PubChem CID | 157464882 |
| Molecular Formula | C25H30F9N |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 1,1'-biphenyl;3-ethyl-N-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)heptan-1-amine |
| SMILES | CCCCC(CC)CCNC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H20F9N.C12H10/c1-3-5-6-9(4-2)7-8-23-13(21,22)11(16,17)10(14,15)12(18,19)20;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h9,23H,3-8H2,1-2H3;1-10H |
| InChIKey | BUIWDTZECWRTHQ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|