C16H25F2N — CID 107820052
N-(2,2-difluoro-2-phenylethyl)-2-ethylhexan-1-amine (PubChem CID 107820052) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-2-ethylhexan-1-amine.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-2-ethylhexan-1-amine |
|---|---|
| PubChem CID | 107820052 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-2-ethylhexan-1-amine |
| SMILES | CCCCC(CC)CNCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H25F2N/c1-3-5-9-14(4-2)12-19-13-16(17,18)15-10-7-6-8-11-15/h6-8,10-11,14,19H,3-5,9,12-13H2,1-2H3 |
| InChIKey | QGNFJLHTCYKJLJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |