C15H22ClF2N — CID 106286047
2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethylpentan-1-amine (PubChem CID 106286047) has the molecular formula C15H22ClF2N and a molecular weight of 289.80 g/mol. Its IUPAC name is 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethylpentan-1-amine.
| Compound Name | 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethylpentan-1-amine |
|---|---|
| PubChem CID | 106286047 |
| Molecular Formula | C15H22ClF2N |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-chloro-N-(2,2-difluoro-2-phenylethyl)-3-ethylpentan-1-amine |
| SMILES | CCC(CC)C(Cl)CNCC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C15H22ClF2N/c1-3-12(4-2)14(16)10-19-11-15(17,18)13-8-6-5-7-9-13/h5-9,12,14,19H,3-4,10-11H2,1-2H3 |
| InChIKey | ONUMNVYBIYKKAN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|