C24H29N3 — CID 59340718
N-(2-ethylhexyl)-2,6-diphenylpyrimidin-4-amine (PubChem CID 59340718) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is N-(2-ethylhexyl)-2,6-diphenylpyrimidin-4-amine.
| Compound Name | N-(2-ethylhexyl)-2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 59340718 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | N-(2-ethylhexyl)-2,6-diphenylpyrimidin-4-amine |
| SMILES | CCCCC(CC)CNc1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H29N3/c1-3-5-12-19(4-2)18-25-23-17-22(20-13-8-6-9-14-20)26-24(27-23)21-15-10-7-11-16-21/h6-11,13-17,19H,3-5,12,18H2,1-2H3,(H,25,26,27) |
| InChIKey | UBLWCWHNFRYLSV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |