C21H23N3 — CID 142806222
N-pentan-2-yl-2,6-diphenylpyrimidin-4-amine (PubChem CID 142806222) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-pentan-2-yl-2,6-diphenylpyrimidin-4-amine.
| Compound Name | N-pentan-2-yl-2,6-diphenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 142806222 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-pentan-2-yl-2,6-diphenylpyrimidin-4-amine |
| SMILES | CCCC(C)Nc1cc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H23N3/c1-3-10-16(2)22-20-15-19(17-11-6-4-7-12-17)23-21(24-20)18-13-8-5-9-14-18/h4-9,11-16H,3,10H2,1-2H3,(H,22,23,24) |
| InChIKey | QGHRDWNKGKDTKK-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |