C27H35N3 — CID 59340782
N-decyl-6-methyl-2-(4-phenylphenyl)pyrimidin-4-amine (PubChem CID 59340782) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-decyl-6-methyl-2-(4-phenylphenyl)pyrimidin-4-amine.
| Compound Name | N-decyl-6-methyl-2-(4-phenylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 59340782 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | N-decyl-6-methyl-2-(4-phenylphenyl)pyrimidin-4-amine |
| SMILES | CCCCCCCCCCNc1cc(C)nc(-c2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C27H35N3/c1-3-4-5-6-7-8-9-13-20-28-26-21-22(2)29-27(30-26)25-18-16-24(17-19-25)23-14-11-10-12-15-23/h10-12,14-19,21H,3-9,13,20H2,1-2H3,(H,28,29,30) |
| InChIKey | BWPILTPXIQCDMO-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|