C13H22N2 — CID 22105749
N-hexyl-4,6-dimethylpyridin-2-amine (PubChem CID 22105749) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-hexyl-4,6-dimethylpyridin-2-amine.
| Compound Name | N-hexyl-4,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 22105749 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-hexyl-4,6-dimethylpyridin-2-amine |
| SMILES | CCCCCCNc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C13H22N2/c1-4-5-6-7-8-14-13-10-11(2)9-12(3)15-13/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | SQOJFINGTJWDQZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|