C13H23N — CID 162753467
pentane;2,4,6-trimethylpyridine (PubChem CID 162753467) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is pentane;2,4,6-trimethylpyridine.
| Compound Name | pentane;2,4,6-trimethylpyridine |
|---|---|
| PubChem CID | 162753467 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | pentane;2,4,6-trimethylpyridine |
| SMILES | CCCCC.Cc1cc(C)nc(C)c1 |
| InChI | InChI=1S/C8H11N.C5H12/c1-6-4-7(2)9-8(3)5-6;1-3-5-4-2/h4-5H,1-3H3;3-5H2,1-2H3 |
| InChIKey | IAMGVLPFJFAISD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |