About ethane;pyridine;2,4,6-trimethylpyridine
ethane;pyridine;2,4,6-trimethylpyridine (PubChem CID 162731023) has the molecular formula C15H22N2
and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;pyridine;2,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | ethane;pyridine;2,4,6-trimethylpyridine |
| PubChem CID | 162731023 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | ethane;pyridine;2,4,6-trimethylpyridine |
| SMILES | CC.Cc1cc(C)nc(C)c1.c1ccncc1 |
| InChI | InChI=1S/C8H11N.C5H5N.C2H6/c1-6-4-7(2)9-8(3)5-6;1-2-4-6-5-3-1;1-2/h4-5H,1-3H3;1-5H;1-2H3 |
| InChIKey | BFNLFCXILKLAAO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;pyridine;2,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;pyridine;2,4,6-trimethylpyridine?
The IUPAC name of ethane;pyridine;2,4,6-trimethylpyridine (CID 162731023) is ethane;pyridine;2,4,6-trimethylpyridine.
What is the SMILES notation for ethane;pyridine;2,4,6-trimethylpyridine?
The canonical SMILES for ethane;pyridine;2,4,6-trimethylpyridine is CC.Cc1cc(C)nc(C)c1.c1ccncc1.
What is the InChIKey of ethane;pyridine;2,4,6-trimethylpyridine?
The InChIKey is BFNLFCXILKLAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C5H5N.C2H6/c1-6-4-7(2)9-8(3)5-6;1-2-4-6-5-3-1;1-2/h4-5H,1-3H3;1-5H;1-2H3.
What are the key properties of ethane;pyridine;2,4,6-trimethylpyridine?
ethane;pyridine;2,4,6-trimethylpyridine has a molecular weight of 230.35 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;pyridine;2,4,6-trimethylpyridine is sourced from PubChem (CID 162731023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).