C13H20N2O — CID 5075598
N-(4,6-dimethyl-2-pyridinyl)hexanamide (PubChem CID 5075598) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)hexanamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 5075598 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)hexanamide |
| SMILES | CCCCCC(=O)Nc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C13H20N2O/c1-4-5-6-7-13(16)15-12-9-10(2)8-11(3)14-12/h8-9H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | BINCYEUZLIUNAO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|