C10H12BN3O2 — CID 10084917
CID 10084917 (PubChem CID 10084917) has the molecular formula C10H12BN3O2 and a molecular weight of 217.04 g/mol.
| Compound Name | CID 10084917 |
|---|---|
| PubChem CID | 10084917 |
| Molecular Formula | C10H12BN3O2 |
| Molecular Weight | 217.04 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | — |
| SMILES | [B]C(=O)NCC(=O)Nc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C10H12BN3O2/c1-6-3-7(2)13-8(4-6)14-9(15)5-12-10(11)16/h3-4H,5H2,1-2H3,(H,12,16)(H,13,14,15) |
| InChIKey | RJVCTULAYGPJOX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.04 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|