C9H11ClN2O — CID 4199160
2-chloro-N-(4,6-dimethyl-2-pyridinyl)acetamide (PubChem CID 4199160) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethyl-2-pyridinyl)acetamide.
| Compound Name | 2-chloro-N-(4,6-dimethyl-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 4199160 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-chloro-N-(4,6-dimethyl-2-pyridinyl)acetamide |
| SMILES | Cc1cc(C)nc(NC(=O)CCl)c1 |
| InChI | InChI=1S/C9H11ClN2O/c1-6-3-7(2)11-8(4-6)12-9(13)5-10/h3-4H,5H2,1-2H3,(H,11,12,13) |
| InChIKey | VNVYARLTTTVRGE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|