C17H30N2 — CID 151938350
N-decyl-4,6-dimethylpyridin-2-amine (PubChem CID 151938350) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-decyl-4,6-dimethylpyridin-2-amine.
| Compound Name | N-decyl-4,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 151938350 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-decyl-4,6-dimethylpyridin-2-amine |
| SMILES | CCCCCCCCCCNc1cc(C)cc(C)n1 |
| InChI | InChI=1S/C17H30N2/c1-4-5-6-7-8-9-10-11-12-18-17-14-15(2)13-16(3)19-17/h13-14H,4-12H2,1-3H3,(H,18,19) |
| InChIKey | TUCWFALMWTXENX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|