C19H27N3 — CID 59340643
N-(2-ethylhexyl)-6-methyl-2-phenylpyrimidin-4-amine (PubChem CID 59340643) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is N-(2-ethylhexyl)-6-methyl-2-phenylpyrimidin-4-amine.
| Compound Name | N-(2-ethylhexyl)-6-methyl-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 59340643 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | N-(2-ethylhexyl)-6-methyl-2-phenylpyrimidin-4-amine |
| SMILES | CCCCC(CC)CNc1cc(C)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H27N3/c1-4-6-10-16(5-2)14-20-18-13-15(3)21-19(22-18)17-11-8-7-9-12-17/h7-9,11-13,16H,4-6,10,14H2,1-3H3,(H,20,21,22) |
| InChIKey | UHBILQUBHVOAIR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |