C19H25N5 — CID 54333376
N-(2-ethylhexyl)-1-phenylpyrazolo[3,4-b]pyrazin-5-amine (PubChem CID 54333376) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(2-ethylhexyl)-1-phenylpyrazolo[3,4-b]pyrazin-5-amine.
| Compound Name | N-(2-ethylhexyl)-1-phenylpyrazolo[3,4-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 54333376 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-(2-ethylhexyl)-1-phenylpyrazolo[3,4-b]pyrazin-5-amine |
| SMILES | CCCCC(CC)CNc1cnc2c(cnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C19H25N5/c1-3-5-9-15(4-2)12-20-18-14-21-19-17(23-18)13-22-24(19)16-10-7-6-8-11-16/h6-8,10-11,13-15H,3-5,9,12H2,1-2H3,(H,20,23) |
| InChIKey | SZXALLHCMOJIIB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |