C18H25F6N — CID 91479214
1,1,2,2,3,3-hexafluoro-4-phenyl-N-propylnonan-1-amine (PubChem CID 91479214) has the molecular formula C18H25F6N and a molecular weight of 369.39 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-4-phenyl-N-propylnonan-1-amine.
| Compound Name | 1,1,2,2,3,3-hexafluoro-4-phenyl-N-propylnonan-1-amine |
|---|---|
| PubChem CID | 91479214 |
| Molecular Formula | C18H25F6N |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-4-phenyl-N-propylnonan-1-amine |
| SMILES | CCCCCC(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)NCCC |
| InChI | InChI=1S/C18H25F6N/c1-3-5-7-12-15(14-10-8-6-9-11-14)16(19,20)17(21,22)18(23,24)25-13-4-2/h6,8-11,15,25H,3-5,7,12-13H2,1-2H3 |
| InChIKey | YENSRCQBHOZXAC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|