C16H22BrF3 — CID 102462937
[(2S,4S)-4-bromo-1,1,1-trifluorodecan-2-yl]benzene (PubChem CID 102462937) has the molecular formula C16H22BrF3 and a molecular weight of 351.25 g/mol. Its IUPAC name is [(2S,4S)-4-bromo-1,1,1-trifluorodecan-2-yl]benzene.
| Compound Name | [(2S,4S)-4-bromo-1,1,1-trifluorodecan-2-yl]benzene |
|---|---|
| PubChem CID | 102462937 |
| Molecular Formula | C16H22BrF3 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(2S,4S)-4-bromo-1,1,1-trifluorodecan-2-yl]benzene |
| SMILES | CCCCCC[C@H](Br)C[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H22BrF3/c1-2-3-4-8-11-14(17)12-15(16(18,19)20)13-9-6-5-7-10-13/h5-7,9-10,14-15H,2-4,8,11-12H2,1H3/t14-,15-/m0/s1 |
| InChIKey | WIXJHQBABUFYHO-GJZGRUSLSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|