C12H11F7 — CID 174807736
4,4,5,5,6,6,6-heptafluorohexan-3-ylbenzene (PubChem CID 174807736) has the molecular formula C12H11F7 and a molecular weight of 288.21 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluorohexan-3-ylbenzene.
| Compound Name | 4,4,5,5,6,6,6-heptafluorohexan-3-ylbenzene |
|---|---|
| PubChem CID | 174807736 |
| Molecular Formula | C12H11F7 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluorohexan-3-ylbenzene |
| SMILES | CCC(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F7/c1-2-9(8-6-4-3-5-7-8)10(13,14)11(15,16)12(17,18)19/h3-7,9H,2H2,1H3 |
| InChIKey | KCMIEAKDUQJLDC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|