C11H10F7O2P — CID 7104501
[(1R)-2,2,3,3,4,4,4-heptafluoro-1-phenylbutyl]-methylphosphinic acid (PubChem CID 7104501) has the molecular formula C11H10F7O2P and a molecular weight of 338.16 g/mol. Its IUPAC name is [(1R)-2,2,3,3,4,4,4-heptafluoro-1-phenylbutyl]-methylphosphinic acid.
| Compound Name | [(1R)-2,2,3,3,4,4,4-heptafluoro-1-phenylbutyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 7104501 |
| Molecular Formula | C11H10F7O2P |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | [(1R)-2,2,3,3,4,4,4-heptafluoro-1-phenylbutyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)[C@H](c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F7O2P/c1-21(19,20)8(7-5-3-2-4-6-7)9(12,13)10(14,15)11(16,17)18/h2-6,8H,1H3,(H,19,20)/t8-/m1/s1 |
| InChIKey | RWLFWCSRVOCWFZ-MRVPVSSYSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|