C15H16F3O7PS — CID 161423023
(1-hydroxy-2,2-diphenylethyl)phosphonic acid;trifluoromethanesulfonic acid (PubChem CID 161423023) has the molecular formula C15H16F3O7PS and a molecular weight of 428.32 g/mol. Its IUPAC name is (1-hydroxy-2,2-diphenylethyl)phosphonic acid;trifluoromethanesulfonic acid.
| Compound Name | (1-hydroxy-2,2-diphenylethyl)phosphonic acid;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 161423023 |
| Molecular Formula | C15H16F3O7PS |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (1-hydroxy-2,2-diphenylethyl)phosphonic acid;trifluoromethanesulfonic acid |
| SMILES | O=P(O)(O)C(O)C(c1ccccc1)c1ccccc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C14H15O4P.CHF3O3S/c15-14(19(16,17)18)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3,4)8(5,6)7/h1-10,13-15H,(H2,16,17,18);(H,5,6,7) |
| InChIKey | VWZJRQDAGQJHAE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|