C19H16F3NO3S — CID 86094513
N,N-diphenylaniline;trifluoromethanesulfonic acid (PubChem CID 86094513) has the molecular formula C19H16F3NO3S and a molecular weight of 395.40 g/mol. Its IUPAC name is N,N-diphenylaniline;trifluoromethanesulfonic acid.
| Compound Name | N,N-diphenylaniline;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 86094513 |
| Molecular Formula | C19H16F3NO3S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N,N-diphenylaniline;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.CHF3O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7/h1-15H;(H,5,6,7) |
| InChIKey | QYBVLIGQHWUPOF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|