C55H39F3N2O3S — CID 58058839
[4-[4-(N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]anilino)phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 58058839) has the molecular formula C55H39F3N2O3S and a molecular weight of 864.99 g/mol. Its IUPAC name is [4-[4-(N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]anilino)phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[4-(N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]anilino)phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 58058839 |
| Molecular Formula | C55H39F3N2O3S |
| Molecular Weight | 864.99 g/mol |
| Exact Mass | 864.26 |
| IUPAC Name | [4-[4-(N-[4-[4-(4-phenyl-N-(4-phenylphenyl)anilino)phenyl]phenyl]anilino)phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc(N(c3ccccc3)c3ccc(-c4ccc(N(c5ccc(-c6ccccc6)cc5)c5ccc(-c6ccccc6)cc5)cc4)cc3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C55H39F3N2O3S/c56-55(57,58)64(61,62)63-54-38-26-47(27-39-54)46-24-34-50(35-25-46)59(48-14-8-3-9-15-48)49-32-20-44(21-33-49)45-22-36-53(37-23-45)60(51-28-16-42(17-29-51)40-10-4-1-5-11-40)52-30-18-43(19-31-52)41-12-6-2-7-13-41/h1-39H |
| InChIKey | CQNMETZBBABGDR-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.99 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|