C62H43F3N2O4S — CID 89209160
[4-[9-(4-hydroxyphenyl)-2,7-bis[4-(N-phenylanilino)phenyl]fluoren-9-yl]phenyl] trifluoromethanesulfonate (PubChem CID 89209160) has the molecular formula C62H43F3N2O4S and a molecular weight of 969.10 g/mol. Its IUPAC name is [4-[9-(4-hydroxyphenyl)-2,7-bis[4-(N-phenylanilino)phenyl]fluoren-9-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[9-(4-hydroxyphenyl)-2,7-bis[4-(N-phenylanilino)phenyl]fluoren-9-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89209160 |
| Molecular Formula | C62H43F3N2O4S |
| Molecular Weight | 969.10 g/mol |
| Exact Mass | 968.29 |
| IUPAC Name | [4-[9-(4-hydroxyphenyl)-2,7-bis[4-(N-phenylanilino)phenyl]fluoren-9-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C2(c3ccc(O)cc3)c3cc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc3-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)cc32)cc1)C(F)(F)F |
| InChI | InChI=1S/C62H43F3N2O4S/c63-62(64,65)72(69,70)71-56-37-29-48(30-38-56)61(47-27-35-55(68)36-28-47)59-41-45(43-21-31-53(32-22-43)66(49-13-5-1-6-14-49)50-15-7-2-8-16-50)25-39-57(59)58-40-26-46(42-60(58)61)44-23-33-54(34-24-44)67(51-17-9-3-10-18-51)52-19-11-4-12-20-52/h1-42,68H |
| InChIKey | IMQORWUWKNYXPI-UHFFFAOYSA-N |
| XLogP | 16.26 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.10 |
| LogP ≤ 5 | 16.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|