C31H22F3NO3S — CID 118006048
[4-(2-phenyl-N-(2-phenylphenyl)anilino)phenyl] trifluoromethanesulfonate (PubChem CID 118006048) has the molecular formula C31H22F3NO3S and a molecular weight of 545.58 g/mol. Its IUPAC name is [4-(2-phenyl-N-(2-phenylphenyl)anilino)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(2-phenyl-N-(2-phenylphenyl)anilino)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118006048 |
| Molecular Formula | C31H22F3NO3S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | [4-(2-phenyl-N-(2-phenylphenyl)anilino)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(N(c2ccccc2-c2ccccc2)c2ccccc2-c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H22F3NO3S/c32-31(33,34)39(36,37)38-26-21-19-25(20-22-26)35(29-17-9-7-15-27(29)23-11-3-1-4-12-23)30-18-10-8-16-28(30)24-13-5-2-6-14-24/h1-22H |
| InChIKey | HCMOUZNEWULUOG-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|