C37H24F3NO3S2 — CID 90337223
[4-phenyl-2-[4-(N-phenylanilino)phenyl]dibenzothiophen-3-yl] trifluoromethanesulfonate (PubChem CID 90337223) has the molecular formula C37H24F3NO3S2 and a molecular weight of 651.73 g/mol. Its IUPAC name is [4-phenyl-2-[4-(N-phenylanilino)phenyl]dibenzothiophen-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-phenyl-2-[4-(N-phenylanilino)phenyl]dibenzothiophen-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90337223 |
| Molecular Formula | C37H24F3NO3S2 |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.11 |
| IUPAC Name | [4-phenyl-2-[4-(N-phenylanilino)phenyl]dibenzothiophen-3-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1c(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc2c(sc3ccccc32)c1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C37H24F3NO3S2/c38-37(39,40)46(42,43)44-35-31(24-32-30-18-10-11-19-33(30)45-36(32)34(35)26-12-4-1-5-13-26)25-20-22-29(23-21-25)41(27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-24H |
| InChIKey | NBQQRJOFOCFBOH-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|