C55H33F3N2O3S4 — CID 157071880
[4-(N-dibenzothiophen-3-ylanilino)-8-[4-(N-dibenzothiophen-2-ylanilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 157071880) has the molecular formula C55H33F3N2O3S4 and a molecular weight of 955.14 g/mol. Its IUPAC name is [4-(N-dibenzothiophen-3-ylanilino)-8-[4-(N-dibenzothiophen-2-ylanilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzothiophen-3-ylanilino)-8-[4-(N-dibenzothiophen-2-ylanilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 157071880 |
| Molecular Formula | C55H33F3N2O3S4 |
| Molecular Weight | 955.14 g/mol |
| Exact Mass | 954.13 |
| IUPAC Name | [4-(N-dibenzothiophen-3-ylanilino)-8-[4-(N-dibenzothiophen-2-ylanilino)phenyl]dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c(c2)sc2ccccc23)c2sc3ccc(-c4ccc(N(c5ccccc5)c5ccc6sc7ccccc7c6c5)cc4)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C55H33F3N2O3S4/c56-55(57,58)67(61,62)63-41-32-47-45-29-35(34-19-22-38(23-20-34)59(36-11-3-1-4-12-36)39-25-28-51-46(30-39)43-16-8-10-18-50(43)64-51)21-27-52(45)66-54(47)48(33-41)60(37-13-5-2-6-14-37)40-24-26-44-42-15-7-9-17-49(42)65-53(44)31-40/h1-33H |
| InChIKey | LEGWZNWXEGNWMC-UHFFFAOYSA-N |
| XLogP | 17.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.14 |
| LogP ≤ 5 | 17.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|