C52H32F3NO3S4 — CID 159461814
[4-[dibenzothiophen-2-yl(dibenzothiophen-3-yl)amino]-8-(9,9-dimethylfluoren-3-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 159461814) has the molecular formula C52H32F3NO3S4 and a molecular weight of 904.09 g/mol. Its IUPAC name is [4-[dibenzothiophen-2-yl(dibenzothiophen-3-yl)amino]-8-(9,9-dimethylfluoren-3-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-[dibenzothiophen-2-yl(dibenzothiophen-3-yl)amino]-8-(9,9-dimethylfluoren-3-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159461814 |
| Molecular Formula | C52H32F3NO3S4 |
| Molecular Weight | 904.09 g/mol |
| Exact Mass | 903.12 |
| IUPAC Name | [4-[dibenzothiophen-2-yl(dibenzothiophen-3-yl)amino]-8-(9,9-dimethylfluoren-3-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccc4sc5c(N(c6ccc7c(c6)sc6ccccc67)c6ccc7sc8ccccc8c7c6)cc(OS(=O)(=O)C(F)(F)F)cc5c4c3)ccc21 |
| InChI | InChI=1S/C52H32F3NO3S4/c1-51(2)42-12-6-3-9-34(42)38-23-29(15-20-43(38)51)30-16-21-48-39(24-30)41-27-33(59-63(57,58)52(53,54)55)28-44(50(41)62-48)56(31-18-22-47-40(25-31)36-11-5-8-14-46(36)60-47)32-17-19-37-35-10-4-7-13-45(35)61-49(37)26-32/h3-28H,1-2H3 |
| InChIKey | PKIWCUXLARYKBP-UHFFFAOYSA-N |
| XLogP | 16.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.09 |
| LogP ≤ 5 | 16.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|