C51H28F3NO5S2 — CID 153311659
[4-(N-dibenzofuran-3-ylanilino)-8-(12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-20-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 153311659) has the molecular formula C51H28F3NO5S2 and a molecular weight of 855.92 g/mol. Its IUPAC name is [4-(N-dibenzofuran-3-ylanilino)-8-(12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-20-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(N-dibenzofuran-3-ylanilino)-8-(12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-20-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311659 |
| Molecular Formula | C51H28F3NO5S2 |
| Molecular Weight | 855.92 g/mol |
| Exact Mass | 855.14 |
| IUPAC Name | [4-(N-dibenzofuran-3-ylanilino)-8-(12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-20-yl)dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc(N(c2ccccc2)c2ccc3c(c2)oc2ccccc23)c2sc3ccc(-c4cc5c(oc6ccc7ccccc7c65)c5ccccc45)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C51H28F3NO5S2/c52-51(53,54)62(56,57)60-33-26-41-40-24-30(39-28-42-48-34-13-5-4-10-29(34)18-22-45(48)59-49(42)38-16-7-6-14-35(38)39)19-23-47(40)61-50(41)43(27-33)55(31-11-2-1-3-12-31)32-20-21-37-36-15-8-9-17-44(36)58-46(37)25-32/h1-28H |
| InChIKey | OQWZTWDIRHKANG-UHFFFAOYSA-N |
| XLogP | 15.52 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.92 |
| LogP ≤ 5 | 15.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|