C53H33F3N2O3S2 — CID 153311679
[8-(7-phenylbenzo[c]carbazol-11-yl)-4-(4-phenyl-N-(2,3,4,5-tetradeuteriophenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate (PubChem CID 153311679) has the molecular formula C53H33F3N2O3S2 and a molecular weight of 871.01 g/mol. Its IUPAC name is [8-(7-phenylbenzo[c]carbazol-11-yl)-4-(4-phenyl-N-(2,3,4,5-tetradeuteriophenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-(7-phenylbenzo[c]carbazol-11-yl)-4-(4-phenyl-N-(2,3,4,5-tetradeuteriophenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 153311679 |
| Molecular Formula | C53H33F3N2O3S2 |
| Molecular Weight | 871.01 g/mol |
| Exact Mass | 870.21 |
| IUPAC Name | [8-(7-phenylbenzo[c]carbazol-11-yl)-4-(4-phenyl-N-(2,3,4,5-tetradeuteriophenyl)anilino)dibenzothiophen-2-yl] trifluoromethanesulfonate |
| SMILES | [2H]c1cc(N(c2ccc(-c3ccccc3)cc2)c2cc(OS(=O)(=O)C(F)(F)F)cc3c2sc2ccc(-c4cccc5c4c4c6ccccc6ccc4n5-c4ccccc4)cc23)c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C53H33F3N2O3S2/c54-53(55,56)63(59,60)61-41-32-45-44-31-37(43-21-12-22-46-51(43)50-42-20-11-10-15-36(42)25-29-47(50)58(46)39-18-8-3-9-19-39)26-30-49(44)62-52(45)48(33-41)57(38-16-6-2-7-17-38)40-27-23-35(24-28-40)34-13-4-1-5-14-34/h1-33H/i2D,6D,7D,16D |
| InChIKey | HFLFEDOYUCXLSL-RFPLYHFHSA-N |
| XLogP | 15.34 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.01 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|