C10H9F6O2P — CID 3711905
methyl-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]phosphinic acid (PubChem CID 3711905) has the molecular formula C10H9F6O2P and a molecular weight of 306.14 g/mol. Its IUPAC name is methyl-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]phosphinic acid.
| Compound Name | methyl-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 3711905 |
| Molecular Formula | C10H9F6O2P |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | methyl-[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]phosphinic acid |
| SMILES | CP(=O)(O)C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C10H9F6O2P/c1-19(17,18)8(10(14,15)16)6-3-2-4-7(5-6)9(11,12)13/h2-5,8H,1H3,(H,17,18) |
| InChIKey | YJNSIIVVTCZRLR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|