C9H8F6N2 — CID 53402398
[2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]hydrazine (PubChem CID 53402398) has the molecular formula C9H8F6N2 and a molecular weight of 258.17 g/mol. Its IUPAC name is [2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]hydrazine.
| Compound Name | [2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]hydrazine |
|---|---|
| PubChem CID | 53402398 |
| Molecular Formula | C9H8F6N2 |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethyl]hydrazine |
| SMILES | NNC(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H8F6N2/c10-8(11,12)6-3-1-2-5(4-6)7(17-16)9(13,14)15/h1-4,7,17H,16H2 |
| InChIKey | CNQLWSOTZPOZKI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|