C16H17F3N2 — CID 105193954
[(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 105193954) has the molecular formula C16H17F3N2 and a molecular weight of 294.32 g/mol. Its IUPAC name is [(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105193954 |
| Molecular Formula | C16H17F3N2 |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [(4-ethylphenyl)-[3-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | CCc1ccc(C(NN)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H17F3N2/c1-2-11-6-8-12(9-7-11)15(21-20)13-4-3-5-14(10-13)16(17,18)19/h3-10,15,21H,2,20H2,1H3 |
| InChIKey | NFHUDPGNXPAVHD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|